C21H25BrN2O3S — CID 27783378
N-[(1R)-1-(4-bromophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 27783378) has the molecular formula C21H25BrN2O3S and a molecular weight of 465.41 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 27783378 |
| Molecular Formula | C21H25BrN2O3S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)N[C@H](C)c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H25BrN2O3S/c1-15-3-9-20(10-4-15)28(26,27)24-13-11-18(12-14-24)21(25)23-16(2)17-5-7-19(22)8-6-17/h3-10,16,18H,11-14H2,1-2H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | XTWRDOGOYGKTPM-MRXNPFEDSA-N |
| XLogP | 4.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |