About 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide
2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide (PubChem CID 2778373) has the molecular formula C6H6ClN3O4
and a molecular weight of 219.58 g/mol. Its IUPAC name is 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 2778373 |
| Molecular Formula | C6H6ClN3O4 |
| Molecular Weight | 219.58 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1noc(NC(=O)CCl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6ClN3O4/c1-3-5(10(12)13)6(14-9-3)8-4(11)2-7/h2H2,1H3,(H,8,11) |
| InChIKey | NVIXDVULTXPNDF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.58 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide?
The IUPAC name of 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide (CID 2778373) is 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide is Cc1noc(NC(=O)CCl)c1[N+](=O)[O-].
What is the InChIKey of 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide?
The InChIKey is NVIXDVULTXPNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3O4/c1-3-5(10(12)13)6(14-9-3)8-4(11)2-7/h2H2,1H3,(H,8,11).
What are the key properties of 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide?
2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide has a molecular weight of 219.58 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-methyl-4-nitro-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 2778373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).