C10H8O4S2 — CID 2778763
3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid (PubChem CID 2778763) has the molecular formula C10H8O4S2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid.
| Compound Name | 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 2778763 |
| Molecular Formula | C10H8O4S2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2sc(C(=O)O)c(C)c12 |
| InChI | InChI=1S/C10H8O4S2/c1-3-5-4(2)7(9(13)14)16-10(5)15-6(3)8(11)12/h1-2H3,(H,11,12)(H,13,14) |
| InChIKey | JARLNIWLMPUVAR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |