About 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde
3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde (PubChem CID 2778771) has the molecular formula C9H8OS2
and a molecular weight of 196.30 g/mol. Its IUPAC name is 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde.
Molecular Properties
| Compound Name | 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde |
| PubChem CID | 2778771 |
| Molecular Formula | C9H8OS2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde |
| SMILES | Cc1csc2sc(C=O)c(C)c12 |
| InChI | InChI=1S/C9H8OS2/c1-5-4-11-9-8(5)6(2)7(3-10)12-9/h3-4H,1-2H3 |
| InChIKey | WEAXSPMHCXWYPF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde?
The IUPAC name of 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde (CID 2778771) is 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde.
What is the SMILES notation for 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde?
The canonical SMILES for 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde is Cc1csc2sc(C=O)c(C)c12.
What is the InChIKey of 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde?
The InChIKey is WEAXSPMHCXWYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8OS2/c1-5-4-11-9-8(5)6(2)7(3-10)12-9/h3-4H,1-2H3.
What are the key properties of 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde?
3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde has a molecular weight of 196.30 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylthieno[2,3-b]thiophene-5-carbaldehyde is sourced from PubChem (CID 2778771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).