C8H9F3N2O4 — CID 2778790
2-(2,5-dioxopyrrol-1-yl)ethylazanium;2,2,2-trifluoroacetate (PubChem CID 2778790) has the molecular formula C8H9F3N2O4 and a molecular weight of 254.16 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethylazanium;2,2,2-trifluoroacetate.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 2778790 |
| Molecular Formula | C8H9F3N2O4 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H8N2O2.C2HF3O2/c7-3-4-8-5(9)1-2-6(8)10;3-2(4,5)1(6)7/h1-2H,3-4,7H2;(H,6,7) |
| InChIKey | YNHKVOGCDPODMT-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|