C4H2ClF7 — CID 2778825
2-chloro-1,1,1,3,4,4,4-heptafluorobutane (PubChem CID 2778825) has the molecular formula C4H2ClF7 and a molecular weight of 218.50 g/mol. Its IUPAC name is 2-chloro-1,1,1,3,4,4,4-heptafluorobutane.
| Compound Name | 2-chloro-1,1,1,3,4,4,4-heptafluorobutane |
|---|---|
| PubChem CID | 2778825 |
| Molecular Formula | C4H2ClF7 |
| Molecular Weight | 218.50 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 2-chloro-1,1,1,3,4,4,4-heptafluorobutane |
| SMILES | FC(C(Cl)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H2ClF7/c5-1(3(7,8)9)2(6)4(10,11)12/h1-2H |
| InChIKey | YCBUFAWATXHLGJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|