About 3,5-dibromo-2,4,6-trifluoropyridine
3,5-dibromo-2,4,6-trifluoropyridine (PubChem CID 2778996) has the molecular formula C5Br2F3N
and a molecular weight of 290.86 g/mol. Its IUPAC name is 3,5-dibromo-2,4,6-trifluoropyridine.
Molecular Properties
| Compound Name | 3,5-dibromo-2,4,6-trifluoropyridine |
| PubChem CID | 2778996 |
| Molecular Formula | C5Br2F3N |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 288.83 |
| IUPAC Name | 3,5-dibromo-2,4,6-trifluoropyridine |
| SMILES | Fc1nc(F)c(Br)c(F)c1Br |
| InChI | InChI=1S/C5Br2F3N/c6-1-3(8)2(7)5(10)11-4(1)9 |
| InChIKey | AEZGFAXIDZYKCA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-2,4,6-trifluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2,4,6-trifluoropyridine?
The IUPAC name of 3,5-dibromo-2,4,6-trifluoropyridine (CID 2778996) is 3,5-dibromo-2,4,6-trifluoropyridine.
What is the SMILES notation for 3,5-dibromo-2,4,6-trifluoropyridine?
The canonical SMILES for 3,5-dibromo-2,4,6-trifluoropyridine is Fc1nc(F)c(Br)c(F)c1Br.
What is the InChIKey of 3,5-dibromo-2,4,6-trifluoropyridine?
The InChIKey is AEZGFAXIDZYKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5Br2F3N/c6-1-3(8)2(7)5(10)11-4(1)9.
What are the key properties of 3,5-dibromo-2,4,6-trifluoropyridine?
3,5-dibromo-2,4,6-trifluoropyridine has a molecular weight of 290.86 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2,4,6-trifluoropyridine is sourced from PubChem (CID 2778996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).