About 2,3-dihydro-1,4-benzodioxine-3-carbothioamide
2,3-dihydro-1,4-benzodioxine-3-carbothioamide (PubChem CID 2779081) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-3-carbothioamide.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxine-3-carbothioamide |
| PubChem CID | 2779081 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-3-carbothioamide |
| SMILES | NC(=S)C1COc2ccccc2O1 |
| InChI | InChI=1S/C9H9NO2S/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-4,8H,5H2,(H2,10,13) |
| InChIKey | ZOHVHNZPAGHKKO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1,4-benzodioxine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxine-3-carbothioamide?
The IUPAC name of 2,3-dihydro-1,4-benzodioxine-3-carbothioamide (CID 2779081) is 2,3-dihydro-1,4-benzodioxine-3-carbothioamide.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxine-3-carbothioamide?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxine-3-carbothioamide is NC(=S)C1COc2ccccc2O1.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxine-3-carbothioamide?
The InChIKey is ZOHVHNZPAGHKKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-4,8H,5H2,(H2,10,13).
What are the key properties of 2,3-dihydro-1,4-benzodioxine-3-carbothioamide?
2,3-dihydro-1,4-benzodioxine-3-carbothioamide has a molecular weight of 195.24 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxine-3-carbothioamide is sourced from PubChem (CID 2779081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).