About difluorotitanium;bis(2-methylcyclopenta-1,3-diene)
difluorotitanium;bis(2-methylcyclopenta-1,3-diene) (PubChem CID 2779173) has the molecular formula C12H14F2Ti-2
and a molecular weight of 244.11 g/mol. Its IUPAC name is difluorotitanium;bis(2-methylcyclopenta-1,3-diene).
Molecular Properties
| Compound Name | difluorotitanium;bis(2-methylcyclopenta-1,3-diene) |
| PubChem CID | 2779173 |
| Molecular Formula | C12H14F2Ti-2 |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | difluorotitanium;bis(2-methylcyclopenta-1,3-diene) |
| SMILES | Cc1cc[cH-]c1.Cc1cc[cH-]c1.F[Ti]F |
| InChI | InChI=1S/2C6H7.2FH.Ti/c2*1-6-4-2-3-5-6;;;/h2*2-5H,1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | AUAZFJHTAXAWAW-UHFFFAOYSA-L |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze difluorotitanium;bis(2-methylcyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluorotitanium;bis(2-methylcyclopenta-1,3-diene)?
The IUPAC name of difluorotitanium;bis(2-methylcyclopenta-1,3-diene) (CID 2779173) is difluorotitanium;bis(2-methylcyclopenta-1,3-diene).
What is the SMILES notation for difluorotitanium;bis(2-methylcyclopenta-1,3-diene)?
The canonical SMILES for difluorotitanium;bis(2-methylcyclopenta-1,3-diene) is Cc1cc[cH-]c1.Cc1cc[cH-]c1.F[Ti]F.
What is the InChIKey of difluorotitanium;bis(2-methylcyclopenta-1,3-diene)?
The InChIKey is AUAZFJHTAXAWAW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H7.2FH.Ti/c2*1-6-4-2-3-5-6;;;/h2*2-5H,1H3;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of difluorotitanium;bis(2-methylcyclopenta-1,3-diene)?
difluorotitanium;bis(2-methylcyclopenta-1,3-diene) has a molecular weight of 244.11 g/mol, XLogP of 4.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluorotitanium;bis(2-methylcyclopenta-1,3-diene) is sourced from PubChem (CID 2779173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).