About 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide
2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide (PubChem CID 2779273) has the molecular formula C8H8N6O2
and a molecular weight of 220.19 g/mol. Its IUPAC name is 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide |
| PubChem CID | 2779273 |
| Molecular Formula | C8H8N6O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1nc(-c2cnccn2)no1 |
| InChI | InChI=1S/C8H8N6O2/c9-13-6(15)3-7-12-8(14-16-7)5-4-10-1-2-11-5/h1-2,4H,3,9H2,(H,13,15) |
| InChIKey | OBZQEORKTFGMFT-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide?
The IUPAC name of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide (CID 2779273) is 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide.
What is the SMILES notation for 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide?
The canonical SMILES for 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide is NNC(=O)Cc1nc(-c2cnccn2)no1.
What is the InChIKey of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide?
The InChIKey is OBZQEORKTFGMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O2/c9-13-6(15)3-7-12-8(14-16-7)5-4-10-1-2-11-5/h1-2,4H,3,9H2,(H,13,15).
What are the key properties of 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide?
2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide has a molecular weight of 220.19 g/mol, XLogP of -0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide is sourced from PubChem (CID 2779273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).