About 3-bromo-4-fluoroaniline
3-bromo-4-fluoroaniline (PubChem CID 2779286) has the molecular formula C6H5BrFN
and a molecular weight of 190.02 g/mol. Its IUPAC name is 3-bromo-4-fluoroaniline.
Molecular Properties
| Compound Name | 3-bromo-4-fluoroaniline |
| PubChem CID | 2779286 |
| Molecular Formula | C6H5BrFN |
| Molecular Weight | 190.02 g/mol |
| Exact Mass | 188.96 |
| IUPAC Name | 3-bromo-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C6H5BrFN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 |
| InChIKey | KOWPUNQBGWIERF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.02 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-fluoroaniline?
The IUPAC name of 3-bromo-4-fluoroaniline (CID 2779286) is 3-bromo-4-fluoroaniline.
What is the SMILES notation for 3-bromo-4-fluoroaniline?
The canonical SMILES for 3-bromo-4-fluoroaniline is Nc1ccc(F)c(Br)c1.
What is the InChIKey of 3-bromo-4-fluoroaniline?
The InChIKey is KOWPUNQBGWIERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrFN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2.
What are the key properties of 3-bromo-4-fluoroaniline?
3-bromo-4-fluoroaniline has a molecular weight of 190.02 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-fluoroaniline is sourced from PubChem (CID 2779286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).