C6H8F8N2 — CID 2779375
2,2,3,3,4,4,5,5-octafluorohexane-1,6-diamine (PubChem CID 2779375) has the molecular formula C6H8F8N2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diamine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diamine |
|---|---|
| PubChem CID | 2779375 |
| Molecular Formula | C6H8F8N2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diamine |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CN |
| InChI | InChI=1S/C6H8F8N2/c7-3(8,1-15)5(11,12)6(13,14)4(9,10)2-16/h1-2,15-16H2 |
| InChIKey | SQYCOUFPSXBQSO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|