C21H27N3 — CID 27794
9-butan-2-yl-3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine (PubChem CID 27794) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is 9-butan-2-yl-3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine.
| Compound Name | 9-butan-2-yl-3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine |
|---|---|
| PubChem CID | 27794 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 9-butan-2-yl-3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine |
| SMILES | CCC(C)c1c2ccc(N(C)C)cc2nc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C21H27N3/c1-7-14(2)21-17-10-8-15(23(3)4)12-19(17)22-20-13-16(24(5)6)9-11-18(20)21/h8-14H,7H2,1-6H3 |
| InChIKey | RMTHKKRHBUPALY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|