C16H17Cl2F3N2O — CID 2779420
4-[4-[(2,4-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 2779420) has the molecular formula C16H17Cl2F3N2O and a molecular weight of 381.23 g/mol. Its IUPAC name is 4-[4-[(2,4-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4-[4-[(2,4-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 2779420 |
| Molecular Formula | C16H17Cl2F3N2O |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 4-[4-[(2,4-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(C=CN1CCCN(Cc2ccc(Cl)cc2Cl)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H17Cl2F3N2O/c17-13-3-2-12(14(18)10-13)11-23-6-1-5-22(8-9-23)7-4-15(24)16(19,20)21/h2-4,7,10H,1,5-6,8-9,11H2 |
| InChIKey | SFQZDDIGGMFERI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|