About furan-3-carboximidamide;hydrochloride
furan-3-carboximidamide;hydrochloride (PubChem CID 2779666) has the molecular formula C5H7ClN2O
and a molecular weight of 146.58 g/mol. Its IUPAC name is furan-3-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | furan-3-carboximidamide;hydrochloride |
| PubChem CID | 2779666 |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | furan-3-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccoc1 |
| InChI | InChI=1S/C5H6N2O.ClH/c6-5(7)4-1-2-8-3-4;/h1-3H,(H3,6,7);1H |
| InChIKey | RJLCJJIXGGSRPZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze furan-3-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-carboximidamide;hydrochloride?
The IUPAC name of furan-3-carboximidamide;hydrochloride (CID 2779666) is furan-3-carboximidamide;hydrochloride.
What is the SMILES notation for furan-3-carboximidamide;hydrochloride?
The canonical SMILES for furan-3-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)c1ccoc1.
What is the InChIKey of furan-3-carboximidamide;hydrochloride?
The InChIKey is RJLCJJIXGGSRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.ClH/c6-5(7)4-1-2-8-3-4;/h1-3H,(H3,6,7);1H.
What are the key properties of furan-3-carboximidamide;hydrochloride?
furan-3-carboximidamide;hydrochloride has a molecular weight of 146.58 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-carboximidamide;hydrochloride is sourced from PubChem (CID 2779666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).