About furan-3-carbothioamide
furan-3-carbothioamide (PubChem CID 2779671) has the molecular formula C5H5NOS
and a molecular weight of 127.17 g/mol. Its IUPAC name is furan-3-carbothioamide.
Molecular Properties
| Compound Name | furan-3-carbothioamide |
| PubChem CID | 2779671 |
| Molecular Formula | C5H5NOS |
| Molecular Weight | 127.17 g/mol |
| Exact Mass | 127.01 |
| IUPAC Name | furan-3-carbothioamide |
| SMILES | NC(=S)c1ccoc1 |
| InChI | InChI=1S/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| InChIKey | FHPWEMZQNZDEMS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze furan-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-carbothioamide?
The IUPAC name of furan-3-carbothioamide (CID 2779671) is furan-3-carbothioamide.
What is the SMILES notation for furan-3-carbothioamide?
The canonical SMILES for furan-3-carbothioamide is NC(=S)c1ccoc1.
What is the InChIKey of furan-3-carbothioamide?
The InChIKey is FHPWEMZQNZDEMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8).
What are the key properties of furan-3-carbothioamide?
furan-3-carbothioamide has a molecular weight of 127.17 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-carbothioamide is sourced from PubChem (CID 2779671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).