About 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid
4-bromo-1,3-dimethylpyrazole-5-carboxylic acid (PubChem CID 2779833) has the molecular formula C6H7BrN2O2
and a molecular weight of 219.04 g/mol. Its IUPAC name is 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid |
| PubChem CID | 2779833 |
| Molecular Formula | C6H7BrN2O2 |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid |
| SMILES | Cc1nn(C)c(C(=O)O)c1Br |
| InChI | InChI=1S/C6H7BrN2O2/c1-3-4(7)5(6(10)11)9(2)8-3/h1-2H3,(H,10,11) |
| InChIKey | ZUEAEVZRYGUFPS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid?
The IUPAC name of 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid (CID 2779833) is 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid.
What is the SMILES notation for 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid?
The canonical SMILES for 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid is Cc1nn(C)c(C(=O)O)c1Br.
What is the InChIKey of 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid?
The InChIKey is ZUEAEVZRYGUFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2O2/c1-3-4(7)5(6(10)11)9(2)8-3/h1-2H3,(H,10,11).
What are the key properties of 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid?
4-bromo-1,3-dimethylpyrazole-5-carboxylic acid has a molecular weight of 219.04 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,3-dimethylpyrazole-5-carboxylic acid is sourced from PubChem (CID 2779833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).