C9H19Cl2N — CID 2780400
4-chloro-2,2,6,6-tetramethylpiperidine;hydrochloride (PubChem CID 2780400) has the molecular formula C9H19Cl2N and a molecular weight of 212.16 g/mol. Its IUPAC name is 4-chloro-2,2,6,6-tetramethylpiperidine;hydrochloride.
| Compound Name | 4-chloro-2,2,6,6-tetramethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 2780400 |
| Molecular Formula | C9H19Cl2N |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-chloro-2,2,6,6-tetramethylpiperidine;hydrochloride |
| SMILES | CC1(C)CC(Cl)CC(C)(C)N1.Cl |
| InChI | InChI=1S/C9H18ClN.ClH/c1-8(2)5-7(10)6-9(3,4)11-8;/h7,11H,5-6H2,1-4H3;1H |
| InChIKey | MCYPZCNAVBMNQB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|