4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride

C7H3Cl2F3O2S — CID 2780719

IUPAC4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Cl)c(C(F)(F)F)c1
InChIInChI=1S/C7H3Cl2F3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H
InChIKeySSULGNXFUGLULI-UHFFFAOYSA-N
MW279.07 g/mol
LogP3.29
Rot. Bonds1

About 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride

4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 2780719) has the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.07 g/mol. Its IUPAC name is 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride
PubChem CID2780719
Molecular FormulaC7H3Cl2F3O2S
Molecular Weight279.07 g/mol
Exact Mass277.92
IUPAC Name4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Cl)c(C(F)(F)F)c1
InChIInChI=1S/C7H3Cl2F3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H
InChIKeySSULGNXFUGLULI-UHFFFAOYSA-N
XLogP3.29
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.07
LogP ≤ 53.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,4-Dichloro-5-methylbenzene-1-sulphonyl chloride
CID 119914
2-Chloro-4-(difluoromethyl)benzene-1-sulfonyl chloride
CID 84710368
4-Chloro-3-methylbenzene-1-sulfonyl chloride
CID 221001
4-chloro-N-methyl-3-(trifluoromethyl)benzene-1-sulfonamide
CID 4557473
2-Chloro-5-(trifluoromethyl)benzene-1-sulfonyl chloride
CID 2734274
4-Chloro-3-(trifluoromethyl)benzene-1-thiol
CID 4961806
2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride
CID 2736675
4-Chloro-2-(trifluoromethyl)benzene-1-sulfonyl chloride
CID 3715205
2,4-Dichloro-3-methylbenzene-1-sulfonyl chloride
CID 15725374
4-Chloro-3-cyanobenzene-1-sulfonyl chloride
CID 18072853
4-Chloro-2-fluoro-5-methylbenzenesulfonyl chloride
CID 18525934
3-Chloro-4-(trifluoromethyl)benzene-1-sulfonyl chloride
CID 22148755

Frequently Asked Questions

What is the IUPAC name of 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride?
The IUPAC name of 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride (CID 2780719) is 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride.
What is the SMILES notation for 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride?
The canonical SMILES for 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(Cl)c(C(F)(F)F)c1.
What is the InChIKey of 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride?
The InChIKey is SSULGNXFUGLULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2F3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H.
What are the key properties of 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride?
4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride has a molecular weight of 279.07 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride is sourced from PubChem (CID 2780719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).