C8H8F8O3 — CID 2780753
2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3-dioxolane (PubChem CID 2780753) has the molecular formula C8H8F8O3 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3-dioxolane.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3-dioxolane |
|---|---|
| PubChem CID | 2780753 |
| Molecular Formula | C8H8F8O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3-dioxolane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COC1OCCO1 |
| InChI | InChI=1S/C8H8F8O3/c9-4(10)7(13,14)8(15,16)6(11,12)3-19-5-17-1-2-18-5/h4-5H,1-3H2 |
| InChIKey | HQDQPOSBNUPLNS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|