C14H17FO3S — CID 2780754
[(2R,6R)-6-fluoro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate (PubChem CID 2780754) has the molecular formula C14H17FO3S and a molecular weight of 284.35 g/mol. Its IUPAC name is [(2R,6R)-6-fluoro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,6R)-6-fluoro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2780754 |
| Molecular Formula | C14H17FO3S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(2R,6R)-6-fluoro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC3CC2[C@H](F)C3)cc1 |
| InChI | InChI=1S/C14H17FO3S/c1-9-2-4-11(5-3-9)19(16,17)18-14-8-10-6-12(14)13(15)7-10/h2-5,10,12-14H,6-8H2,1H3/t10?,12?,13-,14-/m1/s1 |
| InChIKey | BFWVEZWIQRGRNB-CCAROEGRSA-N |
| XLogP | 2.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|