C18H15F6N3O — CID 27809741
[4-(trifluoromethyl)phenyl]-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 27809741) has the molecular formula C18H15F6N3O and a molecular weight of 403.33 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | [4-(trifluoromethyl)phenyl]-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27809741 |
| Molecular Formula | C18H15F6N3O |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C18H15F6N3O/c19-17(20,21)13-3-1-12(2-4-13)16(28)27-9-7-26(8-10-27)15-6-5-14(11-25-15)18(22,23)24/h1-6,11H,7-10H2 |
| InChIKey | JHZQPGSSYPXJQA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |