C9H9NS3 — CID 2781085
3,3-bis(methylsulfanyl)-2-thiophen-2-ylprop-2-enenitrile (PubChem CID 2781085) has the molecular formula C9H9NS3 and a molecular weight of 227.38 g/mol. Its IUPAC name is 3,3-bis(methylsulfanyl)-2-thiophen-2-ylprop-2-enenitrile.
| Compound Name | 3,3-bis(methylsulfanyl)-2-thiophen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 2781085 |
| Molecular Formula | C9H9NS3 |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 3,3-bis(methylsulfanyl)-2-thiophen-2-ylprop-2-enenitrile |
| SMILES | CSC(SC)=C(C#N)c1cccs1 |
| InChI | InChI=1S/C9H9NS3/c1-11-9(12-2)7(6-10)8-4-3-5-13-8/h3-5H,1-2H3 |
| InChIKey | HLUSUYACZQDKCW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|