About anilinothiourea
anilinothiourea (PubChem CID 2781094) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is anilinothiourea.
Molecular Properties
| Compound Name | anilinothiourea |
| PubChem CID | 2781094 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | anilinothiourea |
| SMILES | NC(=S)NNc1ccccc1 |
| InChI | InChI=1S/C7H9N3S/c8-7(11)10-9-6-4-2-1-3-5-6/h1-5,9H,(H3,8,10,11) |
| InChIKey | JDXKTOBMLZLCSB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze anilinothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilinothiourea?
The IUPAC name of anilinothiourea (CID 2781094) is anilinothiourea.
What is the SMILES notation for anilinothiourea?
The canonical SMILES for anilinothiourea is NC(=S)NNc1ccccc1.
What is the InChIKey of anilinothiourea?
The InChIKey is JDXKTOBMLZLCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c8-7(11)10-9-6-4-2-1-3-5-6/h1-5,9H,(H3,8,10,11).
What are the key properties of anilinothiourea?
anilinothiourea has a molecular weight of 167.24 g/mol, XLogP of 0.85, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anilinothiourea is sourced from PubChem (CID 2781094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).