C22H20 — CID 27811
pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22)-octaene (PubChem CID 27811) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22)-octaene.
| Compound Name | pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22)-octaene |
|---|---|
| PubChem CID | 27811 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | pentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22)-octaene |
| SMILES | c1ccc2c(c1)CCc1cc3ccc4c(c3cc1-2)CCCC4 |
| InChI | InChI=1S/C22H20/c1-3-7-19-15(5-1)9-11-17-13-18-12-10-16-6-2-4-8-20(16)22(18)14-21(17)19/h1,3,5,7,10,12-14H,2,4,6,8-9,11H2 |
| InChIKey | ZLANIZQHCMOMHT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |