About 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol
1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol (PubChem CID 2781108) has the molecular formula C13H19FO3
and a molecular weight of 242.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol |
| PubChem CID | 2781108 |
| Molecular Formula | C13H19FO3 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol |
| SMILES | COC(CC(C)(O)Cc1ccc(F)cc1)OC |
| InChI | InChI=1S/C13H19FO3/c1-13(15,9-12(16-2)17-3)8-10-4-6-11(14)7-5-10/h4-7,12,15H,8-9H2,1-3H3 |
| InChIKey | AVZDLLDTMAVFRI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol?
The IUPAC name of 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol (CID 2781108) is 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol.
What is the SMILES notation for 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol?
The canonical SMILES for 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol is COC(CC(C)(O)Cc1ccc(F)cc1)OC.
What is the InChIKey of 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol?
The InChIKey is AVZDLLDTMAVFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FO3/c1-13(15,9-12(16-2)17-3)8-10-4-6-11(14)7-5-10/h4-7,12,15H,8-9H2,1-3H3.
What are the key properties of 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol?
1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol has a molecular weight of 242.29 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-4,4-dimethoxy-2-methylbutan-2-ol is sourced from PubChem (CID 2781108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).