C22H15Cl2N3O4 — CID 2781123
1-(1,3-benzodioxol-5-yl)-3-(4-chloroanilino)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione chloride (PubChem CID 2781123) has the molecular formula C22H15Cl2N3O4 and a molecular weight of 456.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-chloroanilino)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione chloride.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-chloroanilino)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione chloride |
|---|---|
| PubChem CID | 2781123 |
| Molecular Formula | C22H15Cl2N3O4 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-chloroanilino)-4-pyridin-1-ium-1-ylpyrrole-2,5-dione chloride |
| SMILES | O=C1C(Nc2ccc(Cl)cc2)=C([n+]2ccccc2)C(=O)N1c1ccc2c(c1)OCO2.[Cl-] |
| InChI | InChI=1S/C22H14ClN3O4.ClH/c23-14-4-6-15(7-5-14)24-19-20(25-10-2-1-3-11-25)22(28)26(21(19)27)16-8-9-17-18(12-16)30-13-29-17;/h1-12H,13H2;1H |
| InChIKey | JEWSJIBTMAJLOD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|