C18H16ClF2N2S+ — CID 2781300
4-(4-chlorophenyl)-N-(2,4-difluorophenyl)-3-propyl-1,3-thiazol-3-ium-2-amine (PubChem CID 2781300) has the molecular formula C18H16ClF2N2S+ and a molecular weight of 365.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2,4-difluorophenyl)-3-propyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(2,4-difluorophenyl)-3-propyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 2781300 |
| Molecular Formula | C18H16ClF2N2S+ |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2,4-difluorophenyl)-3-propyl-1,3-thiazol-3-ium-2-amine |
| SMILES | CCC[n+]1c(-c2ccc(Cl)cc2)csc1Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H15ClF2N2S/c1-2-9-23-17(12-3-5-13(19)6-4-12)11-24-18(23)22-16-8-7-14(20)10-15(16)21/h3-8,10-11H,2,9H2,1H3/p+1 |
| InChIKey | RBQDJHNTELWYOO-UHFFFAOYSA-O |
| XLogP | 5.79 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|