About 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 2781529) has the molecular formula C11H9ClN2OS
and a molecular weight of 252.73 g/mol. Its IUPAC name is 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2781529 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CCl)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C11H9ClN2OS/c12-6-10(15)14-11-13-9(7-16-11)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,14,15) |
| InChIKey | FFAWPJLADWBKCB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (CID 2781529) is 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is O=C(CCl)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is FFAWPJLADWBKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2OS/c12-6-10(15)14-11-13-9(7-16-11)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,14,15).
What are the key properties of 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 252.73 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2781529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).