C6H7Cl2N3O4S2 — CID 2781602
4-amino-5,6-dichlorobenzene-1,3-disulfonamide (PubChem CID 2781602) has the molecular formula C6H7Cl2N3O4S2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 4-amino-5,6-dichlorobenzene-1,3-disulfonamide.
| Compound Name | 4-amino-5,6-dichlorobenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 2781602 |
| Molecular Formula | C6H7Cl2N3O4S2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 4-amino-5,6-dichlorobenzene-1,3-disulfonamide |
| SMILES | Nc1c(S(N)(=O)=O)cc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C6H7Cl2N3O4S2/c7-4-2(16(10,12)13)1-3(17(11,14)15)6(9)5(4)8/h1H,9H2,(H2,10,12,13)(H2,11,14,15) |
| InChIKey | DNBXGTICJYDFDT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|