2,6-dichloropyridine-4-carbonyl chloride

C6H2Cl3NO — CID 2781643

IUPAC2,6-dichloropyridine-4-carbonyl chloride
SMILESO=C(Cl)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H
InChIKeyQLRUROKTVFUQIV-UHFFFAOYSA-N
MW210.45 g/mol
LogP2.77
Rot. Bonds1

About 2,6-dichloropyridine-4-carbonyl chloride

2,6-dichloropyridine-4-carbonyl chloride (PubChem CID 2781643) has the molecular formula C6H2Cl3NO and a molecular weight of 210.45 g/mol. Its IUPAC name is 2,6-dichloropyridine-4-carbonyl chloride.

Molecular Properties

Compound Name2,6-dichloropyridine-4-carbonyl chloride
PubChem CID2781643
Molecular FormulaC6H2Cl3NO
Molecular Weight210.45 g/mol
Exact Mass208.92
IUPAC Name2,6-dichloropyridine-4-carbonyl chloride
SMILESO=C(Cl)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H
InChIKeyQLRUROKTVFUQIV-UHFFFAOYSA-N
XLogP2.77
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.45
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,6-dichloropyridine-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dichloropyridine-4-carbonyl chloride?
The IUPAC name of 2,6-dichloropyridine-4-carbonyl chloride (CID 2781643) is 2,6-dichloropyridine-4-carbonyl chloride.
What is the SMILES notation for 2,6-dichloropyridine-4-carbonyl chloride?
The canonical SMILES for 2,6-dichloropyridine-4-carbonyl chloride is O=C(Cl)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of 2,6-dichloropyridine-4-carbonyl chloride?
The InChIKey is QLRUROKTVFUQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H.
What are the key properties of 2,6-dichloropyridine-4-carbonyl chloride?
2,6-dichloropyridine-4-carbonyl chloride has a molecular weight of 210.45 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloropyridine-4-carbonyl chloride is sourced from PubChem (CID 2781643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).