About 2-bromo-5-methoxybenzoyl chloride
2-bromo-5-methoxybenzoyl chloride (PubChem CID 2781656) has the molecular formula C8H6BrClO2
and a molecular weight of 249.49 g/mol. Its IUPAC name is 2-bromo-5-methoxybenzoyl chloride.
Molecular Properties
| Compound Name | 2-bromo-5-methoxybenzoyl chloride |
| PubChem CID | 2781656 |
| Molecular Formula | C8H6BrClO2 |
| Molecular Weight | 249.49 g/mol |
| Exact Mass | 247.92 |
| IUPAC Name | 2-bromo-5-methoxybenzoyl chloride |
| SMILES | COc1ccc(Br)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C8H6BrClO2/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3 |
| InChIKey | RZCQJXVXRYIJQE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-methoxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-methoxybenzoyl chloride?
The IUPAC name of 2-bromo-5-methoxybenzoyl chloride (CID 2781656) is 2-bromo-5-methoxybenzoyl chloride.
What is the SMILES notation for 2-bromo-5-methoxybenzoyl chloride?
The canonical SMILES for 2-bromo-5-methoxybenzoyl chloride is COc1ccc(Br)c(C(=O)Cl)c1.
What is the InChIKey of 2-bromo-5-methoxybenzoyl chloride?
The InChIKey is RZCQJXVXRYIJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrClO2/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3.
What are the key properties of 2-bromo-5-methoxybenzoyl chloride?
2-bromo-5-methoxybenzoyl chloride has a molecular weight of 249.49 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-methoxybenzoyl chloride is sourced from PubChem (CID 2781656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).