C11H13Cl2N3O — CID 2781660
2,6-dichloro-N-piperidin-1-ylpyridine-4-carboxamide (PubChem CID 2781660) has the molecular formula C11H13Cl2N3O and a molecular weight of 274.15 g/mol. Its IUPAC name is 2,6-dichloro-N-piperidin-1-ylpyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-piperidin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 2781660 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2,6-dichloro-N-piperidin-1-ylpyridine-4-carboxamide |
| SMILES | O=C(NN1CCCCC1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N3O/c12-9-6-8(7-10(13)14-9)11(17)15-16-4-2-1-3-5-16/h6-7H,1-5H2,(H,15,17) |
| InChIKey | BXIWHMGRSICIDP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|