C18H13Cl2N4O2+ — CID 2781720
3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-5-(pyridin-1-ium-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 2781720) has the molecular formula C18H13Cl2N4O2+ and a molecular weight of 388.23 g/mol. Its IUPAC name is 3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-5-(pyridin-1-ium-1-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-5-(pyridin-1-ium-1-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2781720 |
| Molecular Formula | C18H13Cl2N4O2+ |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-5-(pyridin-1-ium-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1-c1noc(C[n+]2ccccc2)n1 |
| InChI | InChI=1S/C18H13Cl2N4O2/c1-11-15(17(22-25-11)16-12(19)6-5-7-13(16)20)18-21-14(26-23-18)10-24-8-3-2-4-9-24/h2-9H,10H2,1H3/q+1 |
| InChIKey | YSSFVWLHWOWHPY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|