C19H20N6S — CID 27818019
(7R)-7-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 27818019) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is (7R)-7-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (7R)-7-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 27818019 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (7R)-7-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H]1CCc2c(sc3ncnc(NCCc4nnc5ccccn45)c23)C1 |
| InChI | InChI=1S/C19H20N6S/c1-12-5-6-13-14(10-12)26-19-17(13)18(21-11-22-19)20-8-7-16-24-23-15-4-2-3-9-25(15)16/h2-4,9,11-12H,5-8,10H2,1H3,(H,20,21,22)/t12-/m1/s1 |
| InChIKey | QYNJRXLVNKUCAF-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |