C8H9F3N4O2 — CID 2781895
ethyl 4-hydrazinyl-2-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 2781895) has the molecular formula C8H9F3N4O2 and a molecular weight of 250.18 g/mol. Its IUPAC name is ethyl 4-hydrazinyl-2-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-hydrazinyl-2-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2781895 |
| Molecular Formula | C8H9F3N4O2 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | ethyl 4-hydrazinyl-2-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(F)(F)F)nc1NN |
| InChI | InChI=1S/C8H9F3N4O2/c1-2-17-6(16)4-3-13-7(8(9,10)11)14-5(4)15-12/h3H,2,12H2,1H3,(H,13,14,15) |
| InChIKey | YINANUGXXFVGSM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|