About 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene
1,3-dichloro-2-(2,2-diethoxyethoxy)benzene (PubChem CID 2781949) has the molecular formula C12H16Cl2O3
and a molecular weight of 279.16 g/mol. Its IUPAC name is 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene.
Molecular Properties
| Compound Name | 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene |
| PubChem CID | 2781949 |
| Molecular Formula | C12H16Cl2O3 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene |
| SMILES | CCOC(COc1c(Cl)cccc1Cl)OCC |
| InChI | InChI=1S/C12H16Cl2O3/c1-3-15-11(16-4-2)8-17-12-9(13)6-5-7-10(12)14/h5-7,11H,3-4,8H2,1-2H3 |
| InChIKey | RCGUDGMNTDETBY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene?
The IUPAC name of 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene (CID 2781949) is 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene.
What is the SMILES notation for 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene?
The canonical SMILES for 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene is CCOC(COc1c(Cl)cccc1Cl)OCC.
What is the InChIKey of 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene?
The InChIKey is RCGUDGMNTDETBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2O3/c1-3-15-11(16-4-2)8-17-12-9(13)6-5-7-10(12)14/h5-7,11H,3-4,8H2,1-2H3.
What are the key properties of 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene?
1,3-dichloro-2-(2,2-diethoxyethoxy)benzene has a molecular weight of 279.16 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-2-(2,2-diethoxyethoxy)benzene is sourced from PubChem (CID 2781949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).