About 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione
1H-[1,3]thiazolo[5,4-b]pyridine-2-thione (PubChem CID 2782239) has the molecular formula C6H4N2S2
and a molecular weight of 168.25 g/mol. Its IUPAC name is 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione.
Molecular Properties
| Compound Name | 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione |
| PubChem CID | 2782239 |
| Molecular Formula | C6H4N2S2 |
| Molecular Weight | 168.25 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione |
| SMILES | S=c1[nH]c2cccnc2s1 |
| InChI | InChI=1S/C6H4N2S2/c9-6-8-4-2-1-3-7-5(4)10-6/h1-3H,(H,8,9) |
| InChIKey | WITYIAHCBUYCSY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione?
The IUPAC name of 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione (CID 2782239) is 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione.
What is the SMILES notation for 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione?
The canonical SMILES for 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione is S=c1[nH]c2cccnc2s1.
What is the InChIKey of 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione?
The InChIKey is WITYIAHCBUYCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S2/c9-6-8-4-2-1-3-7-5(4)10-6/h1-3H,(H,8,9).
What are the key properties of 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione?
1H-[1,3]thiazolo[5,4-b]pyridine-2-thione has a molecular weight of 168.25 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-[1,3]thiazolo[5,4-b]pyridine-2-thione is sourced from PubChem (CID 2782239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).