About 4-bromo-1,1-difluorobut-1-ene
4-bromo-1,1-difluorobut-1-ene (PubChem CID 2782240) has the molecular formula C4H5BrF2
and a molecular weight of 170.98 g/mol. Its IUPAC name is 4-bromo-1,1-difluorobut-1-ene.
Molecular Properties
| Compound Name | 4-bromo-1,1-difluorobut-1-ene |
| PubChem CID | 2782240 |
| Molecular Formula | C4H5BrF2 |
| Molecular Weight | 170.98 g/mol |
| Exact Mass | 169.95 |
| IUPAC Name | 4-bromo-1,1-difluorobut-1-ene |
| SMILES | FC(F)=CCCBr |
| InChI | InChI=1S/C4H5BrF2/c5-3-1-2-4(6)7/h2H,1,3H2 |
| InChIKey | WSIDFIREQDHYPW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.98 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,1-difluorobut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,1-difluorobut-1-ene?
The IUPAC name of 4-bromo-1,1-difluorobut-1-ene (CID 2782240) is 4-bromo-1,1-difluorobut-1-ene.
What is the SMILES notation for 4-bromo-1,1-difluorobut-1-ene?
The canonical SMILES for 4-bromo-1,1-difluorobut-1-ene is FC(F)=CCCBr.
What is the InChIKey of 4-bromo-1,1-difluorobut-1-ene?
The InChIKey is WSIDFIREQDHYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrF2/c5-3-1-2-4(6)7/h2H,1,3H2.
What are the key properties of 4-bromo-1,1-difluorobut-1-ene?
4-bromo-1,1-difluorobut-1-ene has a molecular weight of 170.98 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,1-difluorobut-1-ene is sourced from PubChem (CID 2782240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).