C6H4F10O — CID 2782285
1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane (PubChem CID 2782285) has the molecular formula C6H4F10O and a molecular weight of 282.08 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane |
|---|---|
| PubChem CID | 2782285 |
| Molecular Formula | C6H4F10O |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,3,3-tetrafluoropropoxy)propane |
| SMILES | FC(F)C(F)(F)COC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F10O/c7-2(5(12,13)14)6(15,16)17-1-4(10,11)3(8)9/h2-3H,1H2 |
| InChIKey | DOESGSGKEZIPFW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|