C28H25F9O6S2 — CID 2782317
tert-butyl 2-[4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-lambda4-sulfanyl]phenoxy]acetate (PubChem CID 2782317) has the molecular formula C28H25F9O6S2 and a molecular weight of 692.62 g/mol. Its IUPAC name is tert-butyl 2-[4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-lambda4-sulfanyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-lambda4-sulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2782317 |
| Molecular Formula | C28H25F9O6S2 |
| Molecular Weight | 692.62 g/mol |
| Exact Mass | 692.09 |
| IUPAC Name | tert-butyl 2-[4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-lambda4-sulfanyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25F9O6S2/c1-24(2,3)42-23(38)18-41-19-14-16-22(17-15-19)44(20-10-6-4-7-11-20,21-12-8-5-9-13-21)43-45(39,40)28(36,37)26(31,32)25(29,30)27(33,34)35/h4-17H,18H2,1-3H3 |
| InChIKey | VTEMSAZNPIWHQK-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.62 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|