About tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate
tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate (PubChem CID 2782318) has the molecular formula C25H25F3O6S2
and a molecular weight of 542.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate |
| PubChem CID | 2782318 |
| Molecular Formula | C25H25F3O6S2 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25F3O6S2/c1-24(2,3)33-23(29)18-32-19-14-16-22(17-15-19)35(20-10-6-4-7-11-20,21-12-8-5-9-13-21)34-36(30,31)25(26,27)28/h4-17H,18H2,1-3H3 |
| InChIKey | VZJISFDHJOINFJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate?
The IUPAC name of tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate (CID 2782318) is tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate.
What is the SMILES notation for tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate?
The canonical SMILES for tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate is CC(C)(C)OC(=O)COc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate?
The InChIKey is VZJISFDHJOINFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F3O6S2/c1-24(2,3)33-23(29)18-32-19-14-16-22(17-15-19)35(20-10-6-4-7-11-20,21-12-8-5-9-13-21)34-36(30,31)25(26,27)28/h4-17H,18H2,1-3H3.
What are the key properties of tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate?
tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate has a molecular weight of 542.60 g/mol, XLogP of 6.47, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[diphenyl(trifluoromethylsulfonyloxy)-lambda4-sulfanyl]phenoxy]acetate is sourced from PubChem (CID 2782318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).