C23H17F9O4S2 — CID 2782328
[(4-methoxyphenyl)-diphenyl-lambda4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 2782328) has the molecular formula C23H17F9O4S2 and a molecular weight of 592.50 g/mol. Its IUPAC name is [(4-methoxyphenyl)-diphenyl-lambda4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(4-methoxyphenyl)-diphenyl-lambda4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 2782328 |
| Molecular Formula | C23H17F9O4S2 |
| Molecular Weight | 592.50 g/mol |
| Exact Mass | 592.04 |
| IUPAC Name | [(4-methoxyphenyl)-diphenyl-lambda4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17F9O4S2/c1-35-16-12-14-19(15-13-16)37(17-8-4-2-5-9-17,18-10-6-3-7-11-18)36-38(33,34)23(31,32)21(26,27)20(24,25)22(28,29)30/h2-15H,1H3 |
| InChIKey | OPSZACNLRHZKST-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|