C6F12 — CID 2782406
(E)-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluorohex-2-ene (PubChem CID 2782406) has the molecular formula C6F12 and a molecular weight of 300.04 g/mol. Its IUPAC name is (E)-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluorohex-2-ene.
| Compound Name | (E)-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluorohex-2-ene |
|---|---|
| PubChem CID | 2782406 |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | (E)-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluorohex-2-ene |
| SMILES | F/C(=C(/F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F12/c7-1(2(8)4(11,12)13)3(9,10)5(14,15)6(16,17)18/b2-1+ |
| InChIKey | JBDBBTPNNYKSQX-OWOJBTEDSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.04 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|