About S-(4-methylphenyl) 2,2,2-trifluoroethanethioate
S-(4-methylphenyl) 2,2,2-trifluoroethanethioate (PubChem CID 2782430) has the molecular formula C9H7F3OS
and a molecular weight of 220.22 g/mol. Its IUPAC name is S-(4-methylphenyl) 2,2,2-trifluoroethanethioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) 2,2,2-trifluoroethanethioate |
| PubChem CID | 2782430 |
| Molecular Formula | C9H7F3OS |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | S-(4-methylphenyl) 2,2,2-trifluoroethanethioate |
| SMILES | Cc1ccc(SC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3OS/c1-6-2-4-7(5-3-6)14-8(13)9(10,11)12/h2-5H,1H3 |
| InChIKey | UTLCXQRJYGDYOK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) 2,2,2-trifluoroethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) 2,2,2-trifluoroethanethioate?
The IUPAC name of S-(4-methylphenyl) 2,2,2-trifluoroethanethioate (CID 2782430) is S-(4-methylphenyl) 2,2,2-trifluoroethanethioate.
What is the SMILES notation for S-(4-methylphenyl) 2,2,2-trifluoroethanethioate?
The canonical SMILES for S-(4-methylphenyl) 2,2,2-trifluoroethanethioate is Cc1ccc(SC(=O)C(F)(F)F)cc1.
What is the InChIKey of S-(4-methylphenyl) 2,2,2-trifluoroethanethioate?
The InChIKey is UTLCXQRJYGDYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3OS/c1-6-2-4-7(5-3-6)14-8(13)9(10,11)12/h2-5H,1H3.
What are the key properties of S-(4-methylphenyl) 2,2,2-trifluoroethanethioate?
S-(4-methylphenyl) 2,2,2-trifluoroethanethioate has a molecular weight of 220.22 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) 2,2,2-trifluoroethanethioate is sourced from PubChem (CID 2782430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).