C20H15F5O3S2 — CID 2782441
(triphenyl-lambda4-sulfanyl) 1,1,2,2,2-pentafluoroethanesulfonate (PubChem CID 2782441) has the molecular formula C20H15F5O3S2 and a molecular weight of 462.46 g/mol. Its IUPAC name is (triphenyl-lambda4-sulfanyl) 1,1,2,2,2-pentafluoroethanesulfonate.
| Compound Name | (triphenyl-lambda4-sulfanyl) 1,1,2,2,2-pentafluoroethanesulfonate |
|---|---|
| PubChem CID | 2782441 |
| Molecular Formula | C20H15F5O3S2 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | (triphenyl-lambda4-sulfanyl) 1,1,2,2,2-pentafluoroethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H15F5O3S2/c21-19(22,23)20(24,25)30(26,27)28-29(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | MJUFFLNOACEJBX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|