About 4,5,5-trifluoropent-4-enoic acid
4,5,5-trifluoropent-4-enoic acid (PubChem CID 2782447) has the molecular formula C5H5F3O2
and a molecular weight of 154.09 g/mol. Its IUPAC name is 4,5,5-trifluoropent-4-enoic acid.
Molecular Properties
| Compound Name | 4,5,5-trifluoropent-4-enoic acid |
| PubChem CID | 2782447 |
| Molecular Formula | C5H5F3O2 |
| Molecular Weight | 154.09 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 4,5,5-trifluoropent-4-enoic acid |
| SMILES | O=C(O)CCC(F)=C(F)F |
| InChI | InChI=1S/C5H5F3O2/c6-3(5(7)8)1-2-4(9)10/h1-2H2,(H,9,10) |
| InChIKey | YWHZHTHRRXAUFQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5,5-trifluoropent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,5-trifluoropent-4-enoic acid?
The IUPAC name of 4,5,5-trifluoropent-4-enoic acid (CID 2782447) is 4,5,5-trifluoropent-4-enoic acid.
What is the SMILES notation for 4,5,5-trifluoropent-4-enoic acid?
The canonical SMILES for 4,5,5-trifluoropent-4-enoic acid is O=C(O)CCC(F)=C(F)F.
What is the InChIKey of 4,5,5-trifluoropent-4-enoic acid?
The InChIKey is YWHZHTHRRXAUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3O2/c6-3(5(7)8)1-2-4(9)10/h1-2H2,(H,9,10).
What are the key properties of 4,5,5-trifluoropent-4-enoic acid?
4,5,5-trifluoropent-4-enoic acid has a molecular weight of 154.09 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,5-trifluoropent-4-enoic acid is sourced from PubChem (CID 2782447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).