About [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine
[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine (PubChem CID 2782508) has the molecular formula C7H3Cl2F5N2
and a molecular weight of 281.01 g/mol. Its IUPAC name is [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine.
Molecular Properties
| Compound Name | [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine |
| PubChem CID | 2782508 |
| Molecular Formula | C7H3Cl2F5N2 |
| Molecular Weight | 281.01 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine |
| SMILES | NNc1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C7H3Cl2F5N2/c8-2-4(10)1(7(12,13)14)5(11)3(9)6(2)16-15/h16H,15H2 |
| InChIKey | QLTSRWAPKUSFOY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.01 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine?
The IUPAC name of [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine (CID 2782508) is [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine.
What is the SMILES notation for [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine?
The canonical SMILES for [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine is NNc1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl.
What is the InChIKey of [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine?
The InChIKey is QLTSRWAPKUSFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2F5N2/c8-2-4(10)1(7(12,13)14)5(11)3(9)6(2)16-15/h16H,15H2.
What are the key properties of [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine?
[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine has a molecular weight of 281.01 g/mol, XLogP of 3.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine is sourced from PubChem (CID 2782508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).