About 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate
2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate (PubChem CID 2782529) has the molecular formula C6H5F5O2
and a molecular weight of 204.09 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate.
Molecular Properties
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate |
| PubChem CID | 2782529 |
| Molecular Formula | C6H5F5O2 |
| Molecular Weight | 204.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H5F5O2/c1-3(7)4(12)13-2-6(10,11)5(8)9/h5H,1-2H2 |
| InChIKey | OOPSTBSKXWPLKJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.09 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate?
The IUPAC name of 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate (CID 2782529) is 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate.
What is the SMILES notation for 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate?
The canonical SMILES for 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate is C=C(F)C(=O)OCC(F)(F)C(F)F.
What is the InChIKey of 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate?
The InChIKey is OOPSTBSKXWPLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F5O2/c1-3(7)4(12)13-2-6(10,11)5(8)9/h5H,1-2H2.
What are the key properties of 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate?
2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate has a molecular weight of 204.09 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3-tetrafluoropropyl 2-fluoroprop-2-enoate is sourced from PubChem (CID 2782529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).