C5H5F7O — CID 2782534
3,3,4,4,5,5,5-heptafluoropentan-1-ol (PubChem CID 2782534) has the molecular formula C5H5F7O and a molecular weight of 214.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentan-1-ol.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentan-1-ol |
|---|---|
| PubChem CID | 2782534 |
| Molecular Formula | C5H5F7O |
| Molecular Weight | 214.08 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentan-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H5F7O/c6-3(7,1-2-13)4(8,9)5(10,11)12/h13H,1-2H2 |
| InChIKey | ROTSWXZIBBJEPH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.08 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|